| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:18 UTC |
|---|
| Update Date | 2025-03-25 01:01:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250075 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18NO5+ |
|---|
| Molecular Mass | 220.1179 |
|---|
| SMILES | C[N+](C)(C)C1COC(O)(C(=O)O)CC1O |
|---|
| InChI Key | VUEXYWAXCTZPJZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pyranoid amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalpha hydroxy acids and derivativesaminescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | carbonyl groupcarboxylic acidpyranoid amino acidalpha-hydroxy acidcarboxylic acid derivativepyran carboxylic acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorganic cationoxaneorganic saltorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativestetraalkylammonium salt1,2-aminoalcoholquaternary ammonium salthydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|
