| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:18 UTC |
|---|
| Update Date | 2025-03-25 01:01:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250082 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H23N2O2+ |
|---|
| Molecular Mass | 215.1754 |
|---|
| SMILES | C[N+](C)(C)C=CCCCC(=O)NCCO |
|---|
| InChI Key | BDPIHMQYONMNDT-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | n-acylethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsquaternary ammonium saltssecondary carboxylic acid amides |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupquaternary ammonium saltfatty amidecarboxamide groupn-acylethanolaminecarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeorganic cationorganic saltorganooxygen compound |
|---|