| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:20 UTC |
|---|
| Update Date | 2025-03-25 01:01:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250179 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22N2O5 |
|---|
| Molecular Mass | 322.1529 |
|---|
| SMILES | O=C(O)c1cccc(C(=O)N2CCN(CCOCCO)CC2)c1 |
|---|
| InChI Key | JADAUZLXBCLWJM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsamino acidsazacyclic compoundsbenzoic acidsbenzoyl derivativescarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpiperazinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | ethercarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidbenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundbenzoic acidtertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
