| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:23 UTC |
|---|
| Update Date | 2025-03-25 01:01:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250289 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O8 |
|---|
| Molecular Mass | 314.1002 |
|---|
| SMILES | O=C(OCC1OC(O)C(O)C(O)C1O)c1ccccc1CO |
|---|
| InChI Key | MVIJPLHCZKAOLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsbenzoyl derivativesbenzyl alcoholscarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholaromatic heteromonocyclic compoundbenzoylmonosaccharidebenzoate esterbenzyl alcoholcarboxylic acid derivativeoxacyclesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
