| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:24 UTC |
|---|
| Update Date | 2025-03-25 01:01:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250318 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12N2O5 |
|---|
| Molecular Mass | 264.0746 |
|---|
| SMILES | O=C(O)COc1cccc(CC2NC(=O)NC2=O)c1 |
|---|
| InChI Key | QSZPASDBJUANQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboximideshydantoinshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compounds |
|---|
| Substituents | imidazolidinephenol etherphenoxyacetatecarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundalpha-amino acid or derivativesalkyl aryl ethercarboxylic acid derivativeimidazolidinoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundcarbonic acid derivativeazacyclemonocarboxylic acid or derivativesorganic oxygen compoundhydantoinhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
