| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:24 UTC |
|---|
| Update Date | 2025-03-25 01:01:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250325 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O8S |
|---|
| Molecular Mass | 282.0409 |
|---|
| SMILES | O=C(O)CSC1C(O)C(O)C(O)C(O)C1C(=O)O |
|---|
| InChI Key | HRCGTWASDPRRMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativesdialkylthioethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidessulfenyl compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidsulfenyl compounddialkylthioethercyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholorganosulfur compoundcarboxylic acid derivativebeta-hydroxy acidorganic oxidethioetheraliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivative |
|---|