| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:26 UTC |
|---|
| Update Date | 2025-03-25 01:01:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250384 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16O11 |
|---|
| Molecular Mass | 360.0693 |
|---|
| SMILES | O=C(O)c1cc(O)c(O)cc1C(=O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | IXBIOKKCXOIZJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-hydroxybenzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarboxylic acid estersdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativeshydroxybenzoic acid derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholsp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidehemiacetal1-carboxy-2-haloaromatic compoundbenzoic acidoxanem-hydroxybenzoic acid esterorganoheterocyclic compoundalcoholp-hydroxybenzoic acid alkyl esterhydroxybenzoic acidoxacycleorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|