| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:32 UTC |
|---|
| Update Date | 2025-03-25 01:01:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250619 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23NO10 |
|---|
| Molecular Mass | 365.1322 |
|---|
| SMILES | O=C1CC2C(O)C(O)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2N1 |
|---|
| InChI Key | OPIWGWBAJNMXGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesindolineslactamsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyrrolidine-2-onessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | 2-pyrrolidonecarbonyl grouplactamindolemonosaccharidecarboxylic acid derivativealiphatic heteropolycyclic compoundsaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxanepyrrolidinedihydroindoleprimary alcoholpyrrolidonealcoholazacyclecyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
