| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:32 UTC |
|---|
| Update Date | 2025-03-25 01:01:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250622 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14NO8P |
|---|
| Molecular Mass | 283.0457 |
|---|
| SMILES | O=C1CC2OP(=O)(O)OC(C(O)C(O)CO)C2N1 |
|---|
| InChI Key | HPOAZYSNBVIDQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrrolidine-2-onessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcohol2-pyrrolidonecarbonyl grouplactamazacyclecarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpyrrolidineprimary alcoholpyrrolidoneorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|