| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:35 UTC |
|---|
| Update Date | 2025-03-25 01:01:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250753 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H27N3O6 |
|---|
| Molecular Mass | 393.19 |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1ccc(NCCCN2CCOCC2)cc1)C(=O)O |
|---|
| InChI Key | MNRNDKNTUYCMTQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesmorpholinesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminessecondary alkylarylaminessecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoyldialkyl etherbenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesazacyclen-acyl-alpha-amino acidhippuric acid or derivativestertiary aliphatic aminebenzoic acid or derivativesglutamic acid or derivativessecondary aminecarboxamide groupoxazinanesecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amidemorpholineorganic oxygen compounddicarboxylic acid or derivativesphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|