| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:38 UTC |
|---|
| Update Date | 2025-03-25 01:01:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250849 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O6 |
|---|
| Molecular Mass | 320.1008 |
|---|
| SMILES | O=C(O)CC(O)C(=NC(O)Cc1c[nH]c2ccccc12)C(=O)O |
|---|
| InChI Key | DIIIDMSEUSLNRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkanolaminesazacyclic compoundsbenzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrrolessecondary alcoholssecondary ketimines |
|---|
| Substituents | ketiminecarbonyl groupcarboxylic acidindoleiminecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundsecondary ketiminebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkanolaminealcoholazacycleheteroaromatic compoundorganic 1,3-dipolar compoundhydroxy acidorganic oxygen compoundpyrrolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|