| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:38 UTC |
|---|
| Update Date | 2025-03-25 01:01:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250851 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8O8S |
|---|
| Molecular Mass | 227.994 |
|---|
| SMILES | O=C(O)CC(O)C(C(=O)O)S(=O)(=O)O |
|---|
| InChI Key | YNMZMUHPYJXWTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic oxidesorganosulfonic acidssecondary alcoholsshort-chain hydroxy acids and derivativessulfonylsthia fatty acids |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidshort-chain hydroxy acidorganosulfonic acidfatty acidorganosulfur compoundcarboxylic acid derivativebeta-hydroxy acidorganic oxidethia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidorganooxygen compound |
|---|