| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:40 UTC |
|---|
| Update Date | 2025-03-25 01:01:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250955 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11NO6S |
|---|
| Molecular Mass | 237.0307 |
|---|
| SMILES | O=C(O)CN(CC(=O)O)C(CS)C(=O)O |
|---|
| InChI Key | ZVFBHJZKXPMYKV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cysteine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkylthiolsalpha amino acidsamino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfur compoundstrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidtertiary aliphatic aminetricarboxylic acid or derivativesorganosulfur compoundorganic oxideorganic oxygen compoundcysteine or derivativesalpha-amino acidorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminealkylthioltertiary amineorganooxygen compound |
|---|
