| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:43 UTC |
|---|
| Update Date | 2025-03-25 01:01:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251038 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO5 |
|---|
| Molecular Mass | 307.142 |
|---|
| SMILES | O=C(O)CCCCCCCC(=O)Nc1ccccc1C(=O)O |
|---|
| InChI Key | UXCPHSZJUZMVHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsamino fatty acidsanilidesbenzoic acidsbenzoyl derivativescarbocyclic fatty acidscarbonyl compoundsdicarboxylic acids and derivativesfatty amideshydrocarbon derivativesmedium-chain fatty acidsn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | fatty acylcarbocyclic fatty acidcarbonyl groupcarboxylic acidfatty amidebenzoylfatty acidn-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundmedium-chain fatty acid1-carboxy-2-haloaromatic compoundbenzoic acidvinylogous amideacylaminobenzoic acid or derivativescarboxamide groupamino fatty acidaromatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
