| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:44 UTC |
|---|
| Update Date | 2025-03-25 01:01:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251092 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO2 |
|---|
| Molecular Mass | 271.1572 |
|---|
| SMILES | OCC(Cc1ccccc1)C(CO)Cc1cccnc1 |
|---|
| InChI Key | DHLJBFGHODHGEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | hydroxypyridines |
|---|
| Direct Parent | hydroxypyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundsprimary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundazacycleheteroaromatic compoundhydroxypyridineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
