| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:46 UTC |
|---|
| Update Date | 2025-03-25 01:01:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251172 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13ClO6 |
|---|
| Molecular Mass | 228.0401 |
|---|
| SMILES | OCC1C(O)C(O)C(O)C(O)(Cl)C1O |
|---|
| InChI Key | IEDANEMSLKZSJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinscyclitols and derivativescyclohexyl halideshydrocarbon derivativesorganochloridesprimary alcohols |
|---|
| Substituents | chlorohydrinhalohydrinalkyl chlorideorganochloridecyclohexanolcyclohexyl halidecyclitol or derivativescyclic alcoholorganohalogen compoundaliphatic homomonocyclic compoundalkyl halidehydrocarbon derivativeprimary alcohol |
|---|