| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:47 UTC |
|---|
| Update Date | 2025-03-25 01:01:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251203 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N4O7P |
|---|
| Molecular Mass | 330.0365 |
|---|
| SMILES | O=c1cnc2c(ncn2C2C(O)C3OP(=O)(O)OC3C2O)[nH]1 |
|---|
| InChI Key | TYKSBTYCNCIOQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrazines |
|---|
| Subclass | imidazopyrazines |
|---|
| Direct Parent | imidazopyrazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrazinessecondary alcohols |
|---|
| Substituents | alcohollactamimidazopyrazineazacycleheteroaromatic compound1,3_dioxaphospholanecyclic alcoholoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazolepyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundazolen-substituted imidazole |
|---|
