| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:54 UTC |
|---|
| Update Date | 2025-03-25 01:01:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251458 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O8 |
|---|
| Molecular Mass | 274.0689 |
|---|
| SMILES | OCC1OC(c2cc(O)c(O)c(O)c2)OC(O)C1O |
|---|
| InChI Key | ATVHGBLHNMYBMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanes1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativeshemiacetalshydrocarbon derivativesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietypyrogallol derivativearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundacetalsecondary alcoholhemiacetalhydrocarbon derivativeprimary alcoholmeta-dioxaneorganoheterocyclic compoundorganooxygen compound |
|---|