| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:54 UTC |
|---|
| Update Date | 2025-03-25 01:01:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251462 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16N2O5 |
|---|
| Molecular Mass | 316.1059 |
|---|
| SMILES | OCC1OC(n2c3cnccc3c3ccc(O)cc32)C(O)C1O |
|---|
| InChI Key | IFKRQENAAZCAEA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | indole ribonucleosides and ribonucleotides |
|---|
| Subclass | indole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | indole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsbeta carbolinesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesindolesmonosaccharidesn-alkylindolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinesprimary alcoholssecondary alcoholssubstituted pyrrolestetrahydrofurans |
|---|
| Substituents | n-alkylindoleindolepolyhalopyridine1-hydroxy-2-unsubstituted benzenoidmonosaccharidesubstituted pyrrole1-ribofuranosylindolesaccharidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholazacycletetrahydrofuranheteroaromatic compoundhydroxypyridineindole or derivativesoxacyclepyridineorganic oxygen compoundpyrrolesecondary alcoholbeta-carbolinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundpyridoindole |
|---|
