| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:55 UTC |
|---|
| Update Date | 2025-03-25 01:01:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251527 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO6 |
|---|
| Molecular Mass | 305.0899 |
|---|
| SMILES | Oc1cc(O)c2c(c1)CC(O)C(c1cc(O)c(O)c(O)c1)N2 |
|---|
| InChI Key | YQHOANJBWFRMEM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativeshydroquinolinesorganopnictogen compoundspyrogallols and derivativessecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | monocyclic benzene moietyphenylquinoline1-hydroxy-2-unsubstituted benzenoidaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtetrahydroquinolinealcoholpyrogallol derivativeazacyclebenzenetriol1-hydroxy-4-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
