| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:59 UTC |
|---|
| Update Date | 2025-03-25 01:01:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251651 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18NO7P |
|---|
| Molecular Mass | 379.0821 |
|---|
| SMILES | O=P(O)(O)OCC1OC(n2c3ccccc3c3ccccc32)C(O)C1O |
|---|
| InChI Key | QPGQHHYPBSXROK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | indole ribonucleosides and ribonucleotides |
|---|
| Subclass | indole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | indole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsbenzenoidscarbazolesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkyl phosphatesmonosaccharidesn-alkylindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatessecondary alcoholssubstituted pyrrolestetrahydrofurans |
|---|
| Substituents | n-alkylindolepentose phosphateindolemonosaccharidepentose-5-phosphatesubstituted pyrrole1-ribofuranosylindolesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compound1,2-diolalcoholazacycletetrahydrofuranheteroaromatic compoundindole or derivativescarbazoleoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
