| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:00 UTC |
|---|
| Update Date | 2025-03-25 01:01:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251687 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H20O24P6 |
|---|
| Molecular Mass | 673.877 |
|---|
| SMILES | O=P(O)(O)OC1C(O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | QWRIJKKLOZNUSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscyclitols and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxides |
|---|
| Substituents | cyclohexanolcyclitol or derivativescyclic alcoholorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate1,2-diol |
|---|