| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:00 UTC |
|---|
| Update Date | 2025-03-25 01:01:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251690 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H14O17P4 |
|---|
| Molecular Mass | 469.9181 |
|---|
| SMILES | O=P(O)(O)OC1(O)OCC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O |
|---|
| InChI Key | LIEOBAGUPKJICE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorthocarboxylic acid derivativesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranoxacycleorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorthocarboxylic acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
