| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:01 UTC |
|---|
| Update Date | 2025-03-25 01:01:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251722 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N2O7 |
|---|
| Molecular Mass | 324.0958 |
|---|
| SMILES | O=C=C(C=C1C=C(C(=O)O)NC(C(=O)O)C1)NCCCC(=O)O |
|---|
| InChI Key | VGLKCLHJVFOMCK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundstetrahydropyridinestricarboxylic acids and derivativesynolates |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acidgamma amino acid or derivativestricarboxylic acid or derivativesalpha-amino acid or derivativesorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundsecondary aliphatic amineazacycletetrahydropyridinesecondary amineorganic oxygen compoundynolatehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
