| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:01 UTC |
|---|
| Update Date | 2025-03-25 01:01:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251738 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16O7 |
|---|
| Molecular Mass | 344.0896 |
|---|
| SMILES | O=C1OCC2C(c3ccc(O)cc3)OC(c3cc(O)c(O)c(O)c3)C12 |
|---|
| InChI Key | DFULNZVEHGRDJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids7,7'-epoxylignansbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersfurofuransgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundspyrogallols and derivativestetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherlignan lactonelactoneorganic oxidearomatic heteropolycyclic compoundfurofuranorganoheterocyclic compoundpyrogallol derivativetetrahydrofuranbenzenetriol1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativetetrahydrofuran lignanbenzenoid7,7p-epoxylignanorganooxygen compound |
|---|