| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:03 UTC |
|---|
| Update Date | 2025-03-25 01:01:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251802 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15O9P |
|---|
| Molecular Mass | 274.0454 |
|---|
| SMILES | O=[PH](O)OCC1(O)C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | VOOPTZHZECUXEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativesorganic oxidesphosphate esterstertiary alcohols |
|---|
| Substituents | cyclohexanolcyclitol or derivativescyclic alcoholtertiary alcoholorganic oxidephosphoric acid esteraliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivative |
|---|