| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:04 UTC |
|---|
| Update Date | 2025-03-25 01:01:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251869 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O10 |
|---|
| Molecular Mass | 356.0743 |
|---|
| SMILES | O=c1cc(O)c2ccc(OC3OC(C(O)O)C(O)C(O)C3O)cc2o1 |
|---|
| InChI Key | RTBYIOZCXVRVJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarin glycosides |
|---|
| Direct Parent | coumarin glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans4-hydroxycoumarinsacetalscarbonyl hydratesheteroaromatic compoundshydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyranones and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | coumarin-7-o-glycosidephenol ethercoumarin o-glycosidecarbonyl hydrate1-benzopyranmonosaccharidelactonesaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compound4-hydroxycoumarinalcoholbenzopyranheteroaromatic compoundoxacyclevinylogous acidorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|