| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:05 UTC |
|---|
| Update Date | 2025-03-25 01:01:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251886 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N4O6P |
|---|
| Molecular Mass | 288.026 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)P(=O)(O)O1 |
|---|
| InChI Key | WGIRGJHNWVVDSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphosphacyclic compoundsphosphonic acid estersprimary alcoholspurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | lactampyrimidonephosphacyclepyrimidinephosphonic acid esterorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganophosphonic acid derivativeazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compound1,4_dioxaphospholaneorganooxygen compound |
|---|