| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251911 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H13NO8S |
|---|
| Molecular Mass | 247.0362 |
|---|
| SMILES | O=S(=O)(O)N(O)CC(O)C(O)C(O)CO |
|---|
| InChI Key | YOPHPCXXPHUIEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesn-organohydroxylaminesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundorganic sulfuric acid or derivativesmonosacchariden-organohydroxylamineorganic oxideorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcohol |
|---|
