| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251925 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O10S |
|---|
| Molecular Mass | 276.0151 |
|---|
| SMILES | O=S(=O)(O)OC1C(O)C(O)C(O)C(O)C1OO |
|---|
| InChI Key | WGKQMAFSBTWTJX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl hydroperoxidesalkyl sulfatescyclitols and derivativeshydrocarbon derivativesorganic oxidesperoxolssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativescyclohexanolhydroperoxidecyclitol or derivativescyclic alcoholperoxolorganic oxidealkyl hydroperoxidealkyl sulfatealiphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|
