| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02251926 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10O9S |
|---|
| Molecular Mass | 246.0046 |
|---|
| SMILES | O=S(=O)(O)OC1OC(O)C(O)(CO)C1O |
|---|
| InChI Key | RUDGNSYDZGLXMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfateshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstertiary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholsulfuric acid monoestertetrahydrofuranmonosaccharideoxacycletertiary alcoholsaccharideorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhemiacetalhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|