| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:09 UTC |
|---|
| Update Date | 2025-03-25 01:01:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252034 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O6S |
|---|
| Molecular Mass | 270.0198 |
|---|
| SMILES | O=S(=O)(O)OCOc1ccc2c(O)cccc2c1 |
|---|
| InChI Key | YNKZKTFMWPJXAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfateshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenol etherssulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoesterorganic sulfuric acid or derivatives1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidorganic oxideorganic oxygen compoundalkyl sulfatesulfate-esterhydrocarbon derivative1-naphtholsulfuric acid esterorganooxygen compound |
|---|
