| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:15 UTC |
|---|
| Update Date | 2025-03-25 01:01:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252264 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16ClN3O7S |
|---|
| Molecular Mass | 393.0397 |
|---|
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)C(=O)N(C1OC(CO)C(O)C1O)CN2 |
|---|
| InChI Key | HVXQLPFIYDERCB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazanaphthalenes |
|---|
| Subclass | benzodiazines |
|---|
| Direct Parent | quinazolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminosulfonyl compoundsaryl chloridesazacyclic compoundsbenzenoidscarboxylic acids and derivativesdiazanaphthaleneshydrocarbon derivativeslactamsmonosaccharidesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsprimary alcoholssecondary alcoholssecondary alkylarylaminestertiary carboxylic acid amidestetrahydrofuransvinylogous amides |
|---|
| Substituents | organosulfonic acid or derivativeslactamamino acid or derivativesorganochloridemonosaccharideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amidesaccharideorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundprimary alcoholaryl chloridealcoholvinylogous amideazacycleaminosulfonyl compoundtetrahydrofuransecondary aminecarboxamide groupsecondary aliphatic/aromatic aminearyl halideoxacyclesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundquinazolineorganooxygen compoundamine |
|---|