| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:18 UTC |
|---|
| Update Date | 2025-03-25 01:01:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252367 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H5I2NO4S |
|---|
| Molecular Mass | 440.8029 |
|---|
| SMILES | Nc1cc(I)c(OS(=O)(=O)O)c(I)c1 |
|---|
| InChI Key | ZAHONKLVOREZBM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl iodideshydrocarbon derivativesiodobenzenesorganic oxidesorganoiodidesorganooxygen compoundsorganopnictogen compoundsphenoxy compoundsprimary aminessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganohalogen compoundiodobenzeneorganoiodidephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundaryl halidearomatic homomonocyclic compoundorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidaryl iodideprimary amineorganic nitrogen compoundhalobenzenephenoxy compoundsulfuric acid esteramineorganooxygen compound |
|---|
