| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:24 UTC |
|---|
| Update Date | 2025-03-25 01:01:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252595 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N3O |
|---|
| Molecular Mass | 219.1372 |
|---|
| SMILES | NC(=O)c1ccc(N2CCCC(N)C2)cc1 |
|---|
| InChI Key | UWGHDIGWAQQRHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesmonoalkylaminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyaromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativebenzamideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary amineazacycleaniline or substituted anilinesbenzoic acid or derivativescarboxamide groupaminobenzamideorganic oxygen compoundphenylpiperidinehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
