| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:24 UTC |
|---|
| Update Date | 2025-03-25 01:01:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252598 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O6P |
|---|
| Molecular Mass | 264.0511 |
|---|
| SMILES | NC(=O)c1ccc(CO)n1CCOP(=O)(O)O |
|---|
| InChI Key | ACLXILMDJUGVTL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrroles |
|---|
| Subclass | pyrrole carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrole carboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesaromatic alcoholsazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessubstituted pyrroles |
|---|
| Substituents | aromatic alcoholprimary carboxylic acid amidearomatic heteromonocyclic compoundsubstituted pyrrolecarboxylic acid derivative2-heteroaryl carboxamideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrole-2-carboxamidealcoholazacycleheteroaromatic compoundcarboxamide grouporganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
