| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:24 UTC |
|---|
| Update Date | 2025-03-25 01:01:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252608 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17BrN2O |
|---|
| Molecular Mass | 332.0524 |
|---|
| SMILES | NC(=O)NCCC(c1ccccc1)c1ccc(Br)cc1 |
|---|
| InChI Key | DEASRRZKEUOIRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl bromidesbromobenzenescarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | diphenylmethanecarbonyl groupcarbonic acid derivativebromobenzeneorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganobromideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenearyl bromideorganooxygen compound |
|---|
