DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:22:26 UTC
Update Date	2025-03-25 01:01:56 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02252649
Frequency	0.5
Structure
Chemical Formula	C₁₄H₂₀N₂O₅
Molecular Mass	296.1372
SMILES	NC(CC(=O)NC(Cc1ccccc1)C(=O)O)C(O)CO
InChI Key	LXWMVXNPPRRKNS-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	peptidomimetics
Subclass	hybrid peptides
Direct Parent	hybrid peptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1,2-diols alpha amino acids amphetamines and derivatives benzene and substituted derivatives beta amino acids and derivatives carbonyl compounds carboxylic acids hydrocarbon derivatives monoalkylamines monocarboxylic acids and derivatives n-acyl amines n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives phenylpropanoic acids primary alcohols secondary alcohols secondary carboxylic acid amides
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid 3-phenylpropanoic-acid fatty amide alpha-amino acid or derivatives carboxylic acid derivative organic oxide organonitrogen compound alpha-amino acid organopnictogen compound primary alcohol amphetamine or derivatives 1,2-diol n-acyl-alpha amino acid or derivatives alcohol n-acyl-alpha-amino acid carboxamide group n-acyl-amine beta amino acid or derivatives aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound secondary alcohol hybrid peptide hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID02252649