| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:31 UTC |
|---|
| Update Date | 2025-03-25 01:01:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252838 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H24N2O9 |
|---|
| Molecular Mass | 364.1482 |
|---|
| SMILES | NC(CCCCNCC1(C(=O)O)CC(O)C(O)C(C(=O)O)O1)C(=O)O |
|---|
| InChI Key | WZALCLGARSXFAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsamino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdialkylamineshydrocarbon derivativesmonoalkylaminesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidamino acidmonosaccharidetricarboxylic acid or derivativesalpha-amino acid or derivativespyran carboxylic aciddialkyl etherbeta-hydroxy acidsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compound1,2-diolalcoholsecondary aliphatic aminepyran carboxylic acid or derivativeshydroxy acidsecondary aminebeta amino acid or derivativesoxacycleorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamine |
|---|
