| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:35 UTC |
|---|
| Update Date | 2025-03-25 01:01:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252996 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O9 |
|---|
| Molecular Mass | 264.0481 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(=O)C(O)(C(=O)O)C1 |
|---|
| InChI Key | OJRDJAVLZZIRFV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acyloinsalpha hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativescyclic ketoneshydrocarbon derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidcyclic ketonehydroxy acidcyclic alcoholketonetertiary alcoholorganic oxideorganic oxygen compoundacyloinsecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|