| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:35 UTC |
|---|
| Update Date | 2025-03-25 01:01:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02252998 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H21NO5 |
|---|
| Molecular Mass | 259.142 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(N2CCCCC2)C1 |
|---|
| InChI Key | GSFLZIZVOIKHNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalpha hydroxy acids and derivativesamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidscyclohexanolscyclohexylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspiperidinestertiary alcoholstrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidalpha-hydroxy acidcyclohexylaminecarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundazacycle1,2-aminoalcoholtertiary aliphatic aminecyclohexanolhydroxy acidtertiary alcoholmonocarboxylic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compoundaminequinic acid |
|---|
