| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:37 UTC |
|---|
| Update Date | 2025-03-25 01:02:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253046 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N2O3 |
|---|
| Molecular Mass | 244.0848 |
|---|
| SMILES | O=C(NCc1ccccn1)c1ccc(O)cc1O |
|---|
| InChI Key | IPJCZMMXAUIIDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsresorcinolssecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | aromatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideresorcinolorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineorganoheterocyclic compoundazacycleheteroaromatic compoundhydroxypyridine1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamidesecondary carboxylic acid amidevinylogous acidpyridineorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|