| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:38 UTC |
|---|
| Update Date | 2025-03-25 01:01:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253077 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O5 |
|---|
| Molecular Mass | 224.0685 |
|---|
| SMILES | O=C(Cc1ccccc1)OC(O)C(=O)CO |
|---|
| InChI Key | FNAJMAAMLMHSJX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alpha-acyloxy ketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalpha-hydroxy ketonesbenzene and substituted derivativescarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxides |
|---|
| Substituents | alcoholmonocyclic benzene moietyalpha-acyloxy ketonemonosaccharidealpha-hydroxy ketonecarboxylic acid derivativeketonearomatic homomonocyclic compoundsaccharideorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterhemiacetalhydrocarbon derivativebenzenoid |
|---|
