| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:38 UTC |
|---|
| Update Date | 2025-03-25 01:02:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253084 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O7 |
|---|
| Molecular Mass | 256.0583 |
|---|
| SMILES | O=C(O)C(CO)OC(C(=O)O)c1cccc(O)c1 |
|---|
| InChI Key | GVPIJKNAJSAOQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzylethers |
|---|
| Direct Parent | benzylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesprimary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidbenzylether1-hydroxy-2-unsubstituted benzenoidhydroxy acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativedialkyl etheraromatic homomonocyclic compoundbeta-hydroxy acidorganic oxideorganic oxygen compoundglyceric_aciddicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|
