| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:38 UTC |
|---|
| Update Date | 2025-03-25 01:02:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253110 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H2O7S |
|---|
| Molecular Mass | 181.9521 |
|---|
| SMILES | O=C(O)C(=O)C(=O)S(=O)(=O)O |
|---|
| InChI Key | XTKZRJFZRYBILG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | alpha-keto acids and derivatives |
|---|
| Direct Parent | alpha-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acylsulfonic acidsalpha-hydroxy ketonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic sulfonic acids and derivativessulfonylsthiolactones |
|---|
| Substituents | acylsulfonic acidaliphatic acyclic compoundcarbonyl groupcarboxylic acidacylsulfonic acid or derivativesorganosulfur compoundalpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesalpha-keto acidhydrocarbon derivativethiolactoneorganooxygen compound |
|---|
