| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:44 UTC |
|---|
| Update Date | 2025-03-25 01:02:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253309 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20O13 |
|---|
| Molecular Mass | 372.0904 |
|---|
| SMILES | O=C(O)C1OC(OC(C(O)CO)C(O)(CO)C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | ZJYVLCARTPSUGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativesbeta hydroxy acids and derivativesbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativesheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholsshort-chain hydroxy acids and derivativestertiary alcohols |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidglucuronic acid or derivativesheterocyclic fatty acidalpha-hydroxy acido-glucuronidemonosaccharidefatty acidcarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaliphatic heteromonocyclic compoundhydroxy fatty acidoxaneprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidbranched fatty acidoxacycletertiary alcoholorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativesaccharolipidorganooxygen compound |
|---|