| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:44 UTC |
|---|
| Update Date | 2025-03-25 01:02:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253327 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8BrNO3 |
|---|
| Molecular Mass | 256.9688 |
|---|
| SMILES | O=C(O)C1CNc2cc(O)c(Br)cc21 |
|---|
| InChI Key | AUBZFMKCFNZQAF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acidsaryl bromidesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesindolesindolinesmonocarboxylic acids and derivativeso-bromophenolsorganic oxidesorganobromidesorganopnictogen compoundssecondary alkylarylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddihydroindole2-bromophenolazacyclesecondary aminesecondary aliphatic/aromatic aminearyl halidemonocarboxylic acid or derivativesorganic oxygen compoundindolecarboxylic acidorganobromidehydrocarbon derivativebenzenoidorganic nitrogen compoundaryl bromideamineorganooxygen compound |
|---|