| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:45 UTC |
|---|
| Update Date | 2025-03-25 01:02:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253335 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O6S |
|---|
| Molecular Mass | 244.0042 |
|---|
| SMILES | O=C(O)C1Cc2cccc(S(=O)(=O)O)c2O1 |
|---|
| InChI Key | XJGSHIHAYLLBEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | arylsulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsalkyl aryl ethersbenzenoidscarbonyl compoundscarboxylic acidscoumaranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acidsoxacyclic compoundssulfonyls |
|---|
| Substituents | carbonyl groupethercarboxylic acid1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acidalkyl aryl etherorganosulfur compoundcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundarylsulfonic acid or derivativesaromatic heteropolycyclic compoundhydrocarbon derivativebenzenoidorganoheterocyclic compoundcoumaranorganooxygen compound |
|---|