| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:45 UTC |
|---|
| Update Date | 2025-03-25 01:02:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253361 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N5O10P |
|---|
| Molecular Mass | 423.0791 |
|---|
| SMILES | Nc1nc2c(ncn2CC2(O)OC(COP(=O)(O)O)C(O)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | FULRFFQNGUVPMK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidoneimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|
