| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:46 UTC |
|---|
| Update Date | 2025-03-25 01:02:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253394 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O |
|---|
| Molecular Mass | 184.0888 |
|---|
| SMILES | C=CC(=O)C1=C(C)c2ccccc2C1 |
|---|
| InChI Key | LLHYFSKQGLPACZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha,beta-unsaturated ketoneshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | ketonecarbonyl grouporganic oxideindeneorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativealpha,beta-unsaturated ketoneorganooxygen compound |
|---|